C15H16Br2N2O2S — CID 17466193
2-[1-(2,5-dibromophenyl)sulfonylpyrrolidin-2-yl]-1-methylpyrrole (PubChem CID 17466193) has the molecular formula C15H16Br2N2O2S and a molecular weight of 448.18 g/mol. Its IUPAC name is 2-[1-(2,5-dibromophenyl)sulfonylpyrrolidin-2-yl]-1-methylpyrrole.
| Compound Name | 2-[1-(2,5-dibromophenyl)sulfonylpyrrolidin-2-yl]-1-methylpyrrole |
|---|---|
| PubChem CID | 17466193 |
| Molecular Formula | C15H16Br2N2O2S |
| Molecular Weight | 448.18 g/mol |
| Exact Mass | 445.93 |
| IUPAC Name | 2-[1-(2,5-dibromophenyl)sulfonylpyrrolidin-2-yl]-1-methylpyrrole |
| SMILES | Cn1cccc1C1CCCN1S(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C15H16Br2N2O2S/c1-18-8-2-4-13(18)14-5-3-9-19(14)22(20,21)15-10-11(16)6-7-12(15)17/h2,4,6-8,10,14H,3,5,9H2,1H3 |
| InChIKey | UHGMCOXLOMIKNW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |