C25H22N6O — CID 174676117
(1S)-8-ethenyl-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]-1H-isoquinoline-1-carbaldehyde (PubChem CID 174676117) has the molecular formula C25H22N6O and a molecular weight of 422.49 g/mol. Its IUPAC name is (1S)-8-ethenyl-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]-1H-isoquinoline-1-carbaldehyde.
| Compound Name | (1S)-8-ethenyl-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]-1H-isoquinoline-1-carbaldehyde |
|---|---|
| PubChem CID | 174676117 |
| Molecular Formula | C25H22N6O |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (1S)-8-ethenyl-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]-1H-isoquinoline-1-carbaldehyde |
| SMILES | C=Cc1cccc2c1[C@@H](C=O)N(c1ccccc1)C(C(C)Nc1ncnc3nc[nH]c13)=C2 |
| InChI | InChI=1S/C25H22N6O/c1-3-17-8-7-9-18-12-20(16(2)30-25-23-24(27-14-26-23)28-15-29-25)31(21(13-32)22(17)18)19-10-5-4-6-11-19/h3-16,21H,1H2,2H3,(H2,26,27,28,29,30)/t16?,21-/m1/s1 |
| InChIKey | SQIPRBANPZVPCJ-CAWMZFRYSA-N |
| XLogP | 4.60 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|