About 8-chloro-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]pyrrolo[1,2-a]pyrazin-1-one
8-chloro-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]pyrrolo[1,2-a]pyrazin-1-one (PubChem CID 90064115) has the molecular formula C20H16ClN7O
and a molecular weight of 405.85 g/mol. Its IUPAC name is 8-chloro-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]pyrrolo[1,2-a]pyrazin-1-one.
Molecular Properties
| Compound Name | 8-chloro-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]pyrrolo[1,2-a]pyrazin-1-one |
| PubChem CID | 90064115 |
| Molecular Formula | C20H16ClN7O |
| Molecular Weight | 405.85 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 8-chloro-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]pyrrolo[1,2-a]pyrazin-1-one |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cn2ccc(Cl)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C20H16ClN7O/c1-12(26-19-16-18(23-10-22-16)24-11-25-19)15-9-27-8-7-14(21)17(27)20(29)28(15)13-5-3-2-4-6-13/h2-12H,1H3,(H2,22,23,24,25,26) |
| InChIKey | QACQSCNRETWPRC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.85 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-chloro-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]pyrrolo[1,2-a]pyrazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]pyrrolo[1,2-a]pyrazin-1-one?
The IUPAC name of 8-chloro-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]pyrrolo[1,2-a]pyrazin-1-one (CID 90064115) is 8-chloro-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]pyrrolo[1,2-a]pyrazin-1-one.
What is the SMILES notation for 8-chloro-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]pyrrolo[1,2-a]pyrazin-1-one?
The canonical SMILES for 8-chloro-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]pyrrolo[1,2-a]pyrazin-1-one is CC(Nc1ncnc2nc[nH]c12)c1cn2ccc(Cl)c2c(=O)n1-c1ccccc1.
What is the InChIKey of 8-chloro-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]pyrrolo[1,2-a]pyrazin-1-one?
The InChIKey is QACQSCNRETWPRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN7O/c1-12(26-19-16-18(23-10-22-16)24-11-25-19)15-9-27-8-7-14(21)17(27)20(29)28(15)13-5-3-2-4-6-13/h2-12H,1H3,(H2,22,23,24,25,26).
What are the key properties of 8-chloro-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]pyrrolo[1,2-a]pyrazin-1-one?
8-chloro-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]pyrrolo[1,2-a]pyrazin-1-one has a molecular weight of 405.85 g/mol, XLogP of 3.58, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-2-phenyl-3-[1-(7H-purin-6-ylamino)ethyl]pyrrolo[1,2-a]pyrazin-1-one is sourced from PubChem (CID 90064115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).