C4H4N4O3 — CID 174682369
formyl(1H-1,2,4-triazol-5-yl)carbamic acid (PubChem CID 174682369) has the molecular formula C4H4N4O3 and a molecular weight of 156.10 g/mol. Its IUPAC name is formyl(1H-1,2,4-triazol-5-yl)carbamic acid.
| Compound Name | formyl(1H-1,2,4-triazol-5-yl)carbamic acid |
|---|---|
| PubChem CID | 174682369 |
| Molecular Formula | C4H4N4O3 |
| Molecular Weight | 156.10 g/mol |
| Exact Mass | 156.03 |
| IUPAC Name | formyl(1H-1,2,4-triazol-5-yl)carbamic acid |
| SMILES | O=CN(C(=O)O)c1ncn[nH]1 |
| InChI | InChI=1S/C4H4N4O3/c9-2-8(4(10)11)3-5-1-6-7-3/h1-2H,(H,10,11)(H,5,6,7) |
| InChIKey | GSBSATZHOYCQDG-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.10 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|