About 2-tert-butylbenzenethiol;fluoro octane-1-sulfonate
2-tert-butylbenzenethiol;fluoro octane-1-sulfonate (PubChem CID 174689059) has the molecular formula C18H31FO3S2
and a molecular weight of 378.58 g/mol. Its IUPAC name is 2-tert-butylbenzenethiol;fluoro octane-1-sulfonate.
Molecular Properties
| Compound Name | 2-tert-butylbenzenethiol;fluoro octane-1-sulfonate |
| PubChem CID | 174689059 |
| Molecular Formula | C18H31FO3S2 |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-tert-butylbenzenethiol;fluoro octane-1-sulfonate |
| SMILES | CC(C)(C)c1ccccc1S.CCCCCCCCS(=O)(=O)OF |
| InChI | InChI=1S/C10H14S.C8H17FO3S/c1-10(2,3)8-6-4-5-7-9(8)11;1-2-3-4-5-6-7-8-13(10,11)12-9/h4-7,11H,1-3H3;2-8H2,1H3 |
| InChIKey | RNDXHNHQGOVECW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylbenzenethiol;fluoro octane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylbenzenethiol;fluoro octane-1-sulfonate?
The IUPAC name of 2-tert-butylbenzenethiol;fluoro octane-1-sulfonate (CID 174689059) is 2-tert-butylbenzenethiol;fluoro octane-1-sulfonate.
What is the SMILES notation for 2-tert-butylbenzenethiol;fluoro octane-1-sulfonate?
The canonical SMILES for 2-tert-butylbenzenethiol;fluoro octane-1-sulfonate is CC(C)(C)c1ccccc1S.CCCCCCCCS(=O)(=O)OF.
What is the InChIKey of 2-tert-butylbenzenethiol;fluoro octane-1-sulfonate?
The InChIKey is RNDXHNHQGOVECW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14S.C8H17FO3S/c1-10(2,3)8-6-4-5-7-9(8)11;1-2-3-4-5-6-7-8-13(10,11)12-9/h4-7,11H,1-3H3;2-8H2,1H3.
What are the key properties of 2-tert-butylbenzenethiol;fluoro octane-1-sulfonate?
2-tert-butylbenzenethiol;fluoro octane-1-sulfonate has a molecular weight of 378.58 g/mol, XLogP of 5.85, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylbenzenethiol;fluoro octane-1-sulfonate is sourced from PubChem (CID 174689059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).