C30H34F2N4O5 — CID 174689515
tert-butyl formate;3-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-N-(2-oxo-2-piperidin-4-ylethyl)benzamide (PubChem CID 174689515) has the molecular formula C30H34F2N4O5 and a molecular weight of 568.62 g/mol. Its IUPAC name is tert-butyl formate;3-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-N-(2-oxo-2-piperidin-4-ylethyl)benzamide.
| Compound Name | tert-butyl formate;3-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-N-(2-oxo-2-piperidin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 174689515 |
| Molecular Formula | C30H34F2N4O5 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | tert-butyl formate;3-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-N-(2-oxo-2-piperidin-4-ylethyl)benzamide |
| SMILES | CC(C)(C)OC=O.O=C(NCC(=O)C1CCNCC1)c1cccc(Cn2nc(-c3cc(F)cc(F)c3)ccc2=O)c1 |
| InChI | InChI=1S/C25H24F2N4O3.C5H10O2/c26-20-11-19(12-21(27)13-20)22-4-5-24(33)31(30-22)15-16-2-1-3-18(10-16)25(34)29-14-23(32)17-6-8-28-9-7-17;1-5(2,3)7-4-6/h1-5,10-13,17,28H,6-9,14-15H2,(H,29,34);4H,1-3H3 |
| InChIKey | XOTMGGUSVKFAPO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|