C14H12N6 — CID 174693268
2-N,9-N-bis(methylideneamino)-1,10-phenanthroline-2,9-diamine (PubChem CID 174693268) has the molecular formula C14H12N6 and a molecular weight of 264.29 g/mol. Its IUPAC name is 2-N,9-N-bis(methylideneamino)-1,10-phenanthroline-2,9-diamine.
| Compound Name | 2-N,9-N-bis(methylideneamino)-1,10-phenanthroline-2,9-diamine |
|---|---|
| PubChem CID | 174693268 |
| Molecular Formula | C14H12N6 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-N,9-N-bis(methylideneamino)-1,10-phenanthroline-2,9-diamine |
| SMILES | C=NNc1ccc2ccc3ccc(NN=C)nc3c2n1 |
| InChI | InChI=1S/C14H12N6/c1-15-19-11-7-5-9-3-4-10-6-8-12(20-16-2)18-14(10)13(9)17-11/h3-8H,1-2H2,(H,17,19)(H,18,20) |
| InChIKey | LOUKFJDTYFVJJK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|