About [3-amino-2-[4-[2-[4-(3,5-dimethylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]-3-oxopropyl] acetate
[3-amino-2-[4-[2-[4-(3,5-dimethylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]-3-oxopropyl] acetate (PubChem CID 174693978) has the molecular formula C24H38N4O3
and a molecular weight of 430.59 g/mol. Its IUPAC name is [3-amino-2-[4-[2-[4-(3,5-dimethylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]-3-oxopropyl] acetate.
Molecular Properties
| Compound Name | [3-amino-2-[4-[2-[4-(3,5-dimethylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]-3-oxopropyl] acetate |
| PubChem CID | 174693978 |
| Molecular Formula | C24H38N4O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | [3-amino-2-[4-[2-[4-(3,5-dimethylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]-3-oxopropyl] acetate |
| SMILES | CC(=O)OCC(C(N)=O)N1CCC(CCN2CCN(c3cc(C)cc(C)c3)CC2)CC1 |
| InChI | InChI=1S/C24H38N4O3/c1-18-14-19(2)16-22(15-18)27-12-10-26(11-13-27)7-4-21-5-8-28(9-6-21)23(24(25)30)17-31-20(3)29/h14-16,21,23H,4-13,17H2,1-3H3,(H2,25,30) |
| InChIKey | MTCGJRVLWSVTHW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-amino-2-[4-[2-[4-(3,5-dimethylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]-3-oxopropyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-2-[4-[2-[4-(3,5-dimethylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]-3-oxopropyl] acetate?
The IUPAC name of [3-amino-2-[4-[2-[4-(3,5-dimethylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]-3-oxopropyl] acetate (CID 174693978) is [3-amino-2-[4-[2-[4-(3,5-dimethylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]-3-oxopropyl] acetate.
What is the SMILES notation for [3-amino-2-[4-[2-[4-(3,5-dimethylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]-3-oxopropyl] acetate?
The canonical SMILES for [3-amino-2-[4-[2-[4-(3,5-dimethylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]-3-oxopropyl] acetate is CC(=O)OCC(C(N)=O)N1CCC(CCN2CCN(c3cc(C)cc(C)c3)CC2)CC1.
What is the InChIKey of [3-amino-2-[4-[2-[4-(3,5-dimethylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]-3-oxopropyl] acetate?
The InChIKey is MTCGJRVLWSVTHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H38N4O3/c1-18-14-19(2)16-22(15-18)27-12-10-26(11-13-27)7-4-21-5-8-28(9-6-21)23(24(25)30)17-31-20(3)29/h14-16,21,23H,4-13,17H2,1-3H3,(H2,25,30).
What are the key properties of [3-amino-2-[4-[2-[4-(3,5-dimethylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]-3-oxopropyl] acetate?
[3-amino-2-[4-[2-[4-(3,5-dimethylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]-3-oxopropyl] acetate has a molecular weight of 430.59 g/mol, XLogP of 1.94, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-2-[4-[2-[4-(3,5-dimethylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]-3-oxopropyl] acetate is sourced from PubChem (CID 174693978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).