C17H16Cl2N2O — CID 174696858
5-(3-chlorophenyl)-6-(5-chloro-2-pyridinyl)piperidine-2-carbaldehyde (PubChem CID 174696858) has the molecular formula C17H16Cl2N2O and a molecular weight of 335.23 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-6-(5-chloro-2-pyridinyl)piperidine-2-carbaldehyde.
| Compound Name | 5-(3-chlorophenyl)-6-(5-chloro-2-pyridinyl)piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174696858 |
| Molecular Formula | C17H16Cl2N2O |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 5-(3-chlorophenyl)-6-(5-chloro-2-pyridinyl)piperidine-2-carbaldehyde |
| SMILES | O=CC1CCC(c2cccc(Cl)c2)C(c2ccc(Cl)cn2)N1 |
| InChI | InChI=1S/C17H16Cl2N2O/c18-12-3-1-2-11(8-12)15-6-5-14(10-22)21-17(15)16-7-4-13(19)9-20-16/h1-4,7-10,14-15,17,21H,5-6H2 |
| InChIKey | JLIDOIULUIJLEE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|