C13H16ClN3 — CID 71129624
(4S,5S)-5-(3-chlorophenyl)-4-methyl-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-2-amine (PubChem CID 71129624) has the molecular formula C13H16ClN3 and a molecular weight of 249.75 g/mol. Its IUPAC name is (4S,5S)-5-(3-chlorophenyl)-4-methyl-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-2-amine.
| Compound Name | (4S,5S)-5-(3-chlorophenyl)-4-methyl-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-2-amine |
|---|---|
| PubChem CID | 71129624 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.75 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (4S,5S)-5-(3-chlorophenyl)-4-methyl-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-2-amine |
| SMILES | C[C@@H]1C2N=C(N)NC2C[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H16ClN3/c1-7-10(8-3-2-4-9(14)5-8)6-11-12(7)17-13(15)16-11/h2-5,7,10-12H,6H2,1H3,(H3,15,16,17)/t7-,10-,11?,12?/m0/s1 |
| InChIKey | OIGYYSYEZPURHT-UDGUHVCISA-N |
| XLogP | 2.12 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.75 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |