C20H21N7O5 — CID 174700259
3-[2-amino-9-[(3,4-dimethoxyphenyl)methyl]-7-methyl-8-oxopurin-6-yl]furan-2-carbohydrazide (PubChem CID 174700259) has the molecular formula C20H21N7O5 and a molecular weight of 439.43 g/mol. Its IUPAC name is 3-[2-amino-9-[(3,4-dimethoxyphenyl)methyl]-7-methyl-8-oxopurin-6-yl]furan-2-carbohydrazide.
| Compound Name | 3-[2-amino-9-[(3,4-dimethoxyphenyl)methyl]-7-methyl-8-oxopurin-6-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 174700259 |
| Molecular Formula | C20H21N7O5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 3-[2-amino-9-[(3,4-dimethoxyphenyl)methyl]-7-methyl-8-oxopurin-6-yl]furan-2-carbohydrazide |
| SMILES | COc1ccc(Cn2c(=O)n(C)c3c(-c4ccoc4C(=O)NN)nc(N)nc32)cc1OC |
| InChI | InChI=1S/C20H21N7O5/c1-26-15-14(11-6-7-32-16(11)18(28)25-22)23-19(21)24-17(15)27(20(26)29)9-10-4-5-12(30-2)13(8-10)31-3/h4-8H,9,22H2,1-3H3,(H,25,28)(H2,21,23,24) |
| InChIKey | NMIKVZCCWCKCGZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 165.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|