C14H16N6O4 — CID 162058248
2-amino-6-[[2-(furan-2-yl)-2-oxoethyl]amino]-9-(2-hydroxyethyl)-7-methylpurin-8-one (PubChem CID 162058248) has the molecular formula C14H16N6O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-amino-6-[[2-(furan-2-yl)-2-oxoethyl]amino]-9-(2-hydroxyethyl)-7-methylpurin-8-one.
| Compound Name | 2-amino-6-[[2-(furan-2-yl)-2-oxoethyl]amino]-9-(2-hydroxyethyl)-7-methylpurin-8-one |
|---|---|
| PubChem CID | 162058248 |
| Molecular Formula | C14H16N6O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-amino-6-[[2-(furan-2-yl)-2-oxoethyl]amino]-9-(2-hydroxyethyl)-7-methylpurin-8-one |
| SMILES | Cn1c(=O)n(CCO)c2nc(N)nc(NCC(=O)c3ccco3)c21 |
| InChI | InChI=1S/C14H16N6O4/c1-19-10-11(16-7-8(22)9-3-2-6-24-9)17-13(15)18-12(10)20(4-5-21)14(19)23/h2-3,6,21H,4-5,7H2,1H3,(H3,15,16,17,18) |
| InChIKey | KYFBPUAHNRQUEM-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 141.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |