C15H19N7O5 — CID 66828314
N'-[2-amino-9-(2-hydroxyethyl)-7-(2-methoxyethyl)-8-oxopurin-6-yl]furan-2-carbohydrazide (PubChem CID 66828314) has the molecular formula C15H19N7O5 and a molecular weight of 377.36 g/mol. Its IUPAC name is N'-[2-amino-9-(2-hydroxyethyl)-7-(2-methoxyethyl)-8-oxopurin-6-yl]furan-2-carbohydrazide.
| Compound Name | N'-[2-amino-9-(2-hydroxyethyl)-7-(2-methoxyethyl)-8-oxopurin-6-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 66828314 |
| Molecular Formula | C15H19N7O5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N'-[2-amino-9-(2-hydroxyethyl)-7-(2-methoxyethyl)-8-oxopurin-6-yl]furan-2-carbohydrazide |
| SMILES | COCCn1c(=O)n(CCO)c2nc(N)nc(NNC(=O)c3ccco3)c21 |
| InChI | InChI=1S/C15H19N7O5/c1-26-8-5-21-10-11(19-20-13(24)9-3-2-7-27-9)17-14(16)18-12(10)22(4-6-23)15(21)25/h2-3,7,23H,4-6,8H2,1H3,(H,20,24)(H3,16,17,18,19) |
| InChIKey | PHSHNYHNACNUMD-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 162.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|