C10H8ClN5O3 — CID 11335027
N'-(2-amino-6-chloro-5-formylpyrimidin-4-yl)furan-2-carbohydrazide (PubChem CID 11335027) has the molecular formula C10H8ClN5O3 and a molecular weight of 281.66 g/mol. Its IUPAC name is N'-(2-amino-6-chloro-5-formylpyrimidin-4-yl)furan-2-carbohydrazide.
| Compound Name | N'-(2-amino-6-chloro-5-formylpyrimidin-4-yl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 11335027 |
| Molecular Formula | C10H8ClN5O3 |
| Molecular Weight | 281.66 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | N'-(2-amino-6-chloro-5-formylpyrimidin-4-yl)furan-2-carbohydrazide |
| SMILES | Nc1nc(Cl)c(C=O)c(NNC(=O)c2ccco2)n1 |
| InChI | InChI=1S/C10H8ClN5O3/c11-7-5(4-17)8(14-10(12)13-7)15-16-9(18)6-2-1-3-19-6/h1-4H,(H,16,18)(H3,12,13,14,15) |
| InChIKey | IIEAJFVQJSLSPU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.66 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|