C7H18N2Si — CID 174702891
(2,2,3-trimethyl-1,3-diazinan-1-yl)silane (PubChem CID 174702891) has the molecular formula C7H18N2Si and a molecular weight of 158.32 g/mol. Its IUPAC name is (2,2,3-trimethyl-1,3-diazinan-1-yl)silane.
| Compound Name | (2,2,3-trimethyl-1,3-diazinan-1-yl)silane |
|---|---|
| PubChem CID | 174702891 |
| Molecular Formula | C7H18N2Si |
| Molecular Weight | 158.32 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | (2,2,3-trimethyl-1,3-diazinan-1-yl)silane |
| SMILES | CN1CCCN([SiH3])C1(C)C |
| InChI | InChI=1S/C7H18N2Si/c1-7(2)8(3)5-4-6-9(7)10/h4-6H2,1-3,10H3 |
| InChIKey | OYAMPRCBTVBUKR-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.32 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|