C15H26O2Si2 — CID 174703394
(2,2,4,5,5-pentamethyl-6-phenyloxasilinan-6-yl)oxysilane (PubChem CID 174703394) has the molecular formula C15H26O2Si2 and a molecular weight of 294.54 g/mol. Its IUPAC name is (2,2,4,5,5-pentamethyl-6-phenyloxasilinan-6-yl)oxysilane.
| Compound Name | (2,2,4,5,5-pentamethyl-6-phenyloxasilinan-6-yl)oxysilane |
|---|---|
| PubChem CID | 174703394 |
| Molecular Formula | C15H26O2Si2 |
| Molecular Weight | 294.54 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (2,2,4,5,5-pentamethyl-6-phenyloxasilinan-6-yl)oxysilane |
| SMILES | CC1C[Si](C)(C)OC(O[SiH3])(c2ccccc2)C1(C)C |
| InChI | InChI=1S/C15H26O2Si2/c1-12-11-19(4,5)17-15(16-18,14(12,2)3)13-9-7-6-8-10-13/h6-10,12H,11H2,1-5,18H3 |
| InChIKey | GDQUCVROSPHBPX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|