About ethyl(trimethyl)azanium;methanesulfonate;methyl prop-2-enoate
ethyl(trimethyl)azanium;methanesulfonate;methyl prop-2-enoate (PubChem CID 174712133) has the molecular formula C10H23NO5S
and a molecular weight of 269.36 g/mol. Its IUPAC name is ethyl(trimethyl)azanium;methanesulfonate;methyl prop-2-enoate.
Molecular Properties
| Compound Name | ethyl(trimethyl)azanium;methanesulfonate;methyl prop-2-enoate |
| PubChem CID | 174712133 |
| Molecular Formula | C10H23NO5S |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | ethyl(trimethyl)azanium;methanesulfonate;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.CC[N+](C)(C)C.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C5H14N.C4H6O2.CH4O3S/c1-5-6(2,3)4;1-3-4(5)6-2;1-5(2,3)4/h5H2,1-4H3;3H,1H2,2H3;1H3,(H,2,3,4)/q+1;;/p-1 |
| InChIKey | OQXZBGZIFVIBNF-UHFFFAOYSA-M |
| XLogP | 0.22 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl(trimethyl)azanium;methanesulfonate;methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(trimethyl)azanium;methanesulfonate;methyl prop-2-enoate?
The IUPAC name of ethyl(trimethyl)azanium;methanesulfonate;methyl prop-2-enoate (CID 174712133) is ethyl(trimethyl)azanium;methanesulfonate;methyl prop-2-enoate.
What is the SMILES notation for ethyl(trimethyl)azanium;methanesulfonate;methyl prop-2-enoate?
The canonical SMILES for ethyl(trimethyl)azanium;methanesulfonate;methyl prop-2-enoate is C=CC(=O)OC.CC[N+](C)(C)C.CS(=O)(=O)[O-].
What is the InChIKey of ethyl(trimethyl)azanium;methanesulfonate;methyl prop-2-enoate?
The InChIKey is OQXZBGZIFVIBNF-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H14N.C4H6O2.CH4O3S/c1-5-6(2,3)4;1-3-4(5)6-2;1-5(2,3)4/h5H2,1-4H3;3H,1H2,2H3;1H3,(H,2,3,4)/q+1;;/p-1.
What are the key properties of ethyl(trimethyl)azanium;methanesulfonate;methyl prop-2-enoate?
ethyl(trimethyl)azanium;methanesulfonate;methyl prop-2-enoate has a molecular weight of 269.36 g/mol, XLogP of 0.22, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(trimethyl)azanium;methanesulfonate;methyl prop-2-enoate is sourced from PubChem (CID 174712133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).