C19H29NO3 — CID 174713677
1-[4-hydroxy-1-(2-phenylethyl)piperidin-4-yl]propyl propanoate (PubChem CID 174713677) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is 1-[4-hydroxy-1-(2-phenylethyl)piperidin-4-yl]propyl propanoate.
| Compound Name | 1-[4-hydroxy-1-(2-phenylethyl)piperidin-4-yl]propyl propanoate |
|---|---|
| PubChem CID | 174713677 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 1-[4-hydroxy-1-(2-phenylethyl)piperidin-4-yl]propyl propanoate |
| SMILES | CCC(=O)OC(CC)C1(O)CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H29NO3/c1-3-17(23-18(21)4-2)19(22)11-14-20(15-12-19)13-10-16-8-6-5-7-9-16/h5-9,17,22H,3-4,10-15H2,1-2H3 |
| InChIKey | ZRLNOMOLXHVULB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |