C15H21FO3 — CID 174719583
fluoro 2,4-ditert-butylbenzenecarboperoxoate (PubChem CID 174719583) has the molecular formula C15H21FO3 and a molecular weight of 268.33 g/mol. Its IUPAC name is fluoro 2,4-ditert-butylbenzenecarboperoxoate.
| Compound Name | fluoro 2,4-ditert-butylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 174719583 |
| Molecular Formula | C15H21FO3 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | fluoro 2,4-ditert-butylbenzenecarboperoxoate |
| SMILES | CC(C)(C)c1ccc(C(=O)OOF)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H21FO3/c1-14(2,3)10-7-8-11(13(17)18-19-16)12(9-10)15(4,5)6/h7-9H,1-6H3 |
| InChIKey | KNKAUMCBHPVCIS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|