About (E)-2,3-bis(3,5-dimethylphenyl)but-2-enediamide
(E)-2,3-bis(3,5-dimethylphenyl)but-2-enediamide (PubChem CID 174720446) has the molecular formula C20H22N2O2
and a molecular weight of 322.41 g/mol. Its IUPAC name is (E)-2,3-bis(3,5-dimethylphenyl)but-2-enediamide.
Molecular Properties
| Compound Name | (E)-2,3-bis(3,5-dimethylphenyl)but-2-enediamide |
| PubChem CID | 174720446 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (E)-2,3-bis(3,5-dimethylphenyl)but-2-enediamide |
| SMILES | Cc1cc(C)cc(/C(C(N)=O)=C(\C(N)=O)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C20H22N2O2/c1-11-5-12(2)8-15(7-11)17(19(21)23)18(20(22)24)16-9-13(3)6-14(4)10-16/h5-10H,1-4H3,(H2,21,23)(H2,22,24)/b18-17+ |
| InChIKey | YAGVNHMRTNCOQM-ISLYRVAYSA-N |
| XLogP | 2.80 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,3-bis(3,5-dimethylphenyl)but-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-bis(3,5-dimethylphenyl)but-2-enediamide?
The IUPAC name of (E)-2,3-bis(3,5-dimethylphenyl)but-2-enediamide (CID 174720446) is (E)-2,3-bis(3,5-dimethylphenyl)but-2-enediamide.
What is the SMILES notation for (E)-2,3-bis(3,5-dimethylphenyl)but-2-enediamide?
The canonical SMILES for (E)-2,3-bis(3,5-dimethylphenyl)but-2-enediamide is Cc1cc(C)cc(/C(C(N)=O)=C(\C(N)=O)c2cc(C)cc(C)c2)c1.
What is the InChIKey of (E)-2,3-bis(3,5-dimethylphenyl)but-2-enediamide?
The InChIKey is YAGVNHMRTNCOQM-ISLYRVAYSA-N. The full InChI is InChI=1S/C20H22N2O2/c1-11-5-12(2)8-15(7-11)17(19(21)23)18(20(22)24)16-9-13(3)6-14(4)10-16/h5-10H,1-4H3,(H2,21,23)(H2,22,24)/b18-17+.
What are the key properties of (E)-2,3-bis(3,5-dimethylphenyl)but-2-enediamide?
(E)-2,3-bis(3,5-dimethylphenyl)but-2-enediamide has a molecular weight of 322.41 g/mol, XLogP of 2.80, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-bis(3,5-dimethylphenyl)but-2-enediamide is sourced from PubChem (CID 174720446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).