C22H21N — CID 174721362
1,1,2-trimethyl-5,6-dihydro-4H-chrysene-3-carbonitrile (PubChem CID 174721362) has the molecular formula C22H21N and a molecular weight of 299.42 g/mol. Its IUPAC name is 1,1,2-trimethyl-5,6-dihydro-4H-chrysene-3-carbonitrile.
| Compound Name | 1,1,2-trimethyl-5,6-dihydro-4H-chrysene-3-carbonitrile |
|---|---|
| PubChem CID | 174721362 |
| Molecular Formula | C22H21N |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1,1,2-trimethyl-5,6-dihydro-4H-chrysene-3-carbonitrile |
| SMILES | CC1=C(C#N)Cc2c(ccc3c2CCc2ccccc2-3)C1(C)C |
| InChI | InChI=1S/C22H21N/c1-14-16(13-23)12-20-19-9-8-15-6-4-5-7-17(15)18(19)10-11-21(20)22(14,2)3/h4-7,10-11H,8-9,12H2,1-3H3 |
| InChIKey | RSNHZKHCMIOJNT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |