C26H28N2 — CID 175234898
6,6-dimethyl-1H-cyclopenta[d]pyrazole;1,2,3,4,5,6-hexahydrochrysene (PubChem CID 175234898) has the molecular formula C26H28N2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 6,6-dimethyl-1H-cyclopenta[d]pyrazole;1,2,3,4,5,6-hexahydrochrysene.
| Compound Name | 6,6-dimethyl-1H-cyclopenta[d]pyrazole;1,2,3,4,5,6-hexahydrochrysene |
|---|---|
| PubChem CID | 175234898 |
| Molecular Formula | C26H28N2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 6,6-dimethyl-1H-cyclopenta[d]pyrazole;1,2,3,4,5,6-hexahydrochrysene |
| SMILES | CC1(C)C=Cc2cn[nH]c21.c1ccc2c(c1)CCc1c-2ccc2c1CCCC2 |
| InChI | InChI=1S/C18H18.C8H10N2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-8(2)4-3-6-5-9-10-7(6)8/h1,3,5,7,10,12H,2,4,6,8-9,11H2;3-5H,1-2H3,(H,9,10) |
| InChIKey | XDABEEFSNHEXTL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |