C27H26N2 — CID 174271314
3H-1,4-benzodiazepine;1,2,3,4,5,6-hexahydrochrysene (PubChem CID 174271314) has the molecular formula C27H26N2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 3H-1,4-benzodiazepine;1,2,3,4,5,6-hexahydrochrysene.
| Compound Name | 3H-1,4-benzodiazepine;1,2,3,4,5,6-hexahydrochrysene |
|---|---|
| PubChem CID | 174271314 |
| Molecular Formula | C27H26N2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 3H-1,4-benzodiazepine;1,2,3,4,5,6-hexahydrochrysene |
| SMILES | C1=NCC=Nc2ccccc21.c1ccc2c(c1)CCc1c-2ccc2c1CCCC2 |
| InChI | InChI=1S/C18H18.C9H8N2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-4-9-8(3-1)7-10-5-6-11-9/h1,3,5,7,10,12H,2,4,6,8-9,11H2;1-4,6-7H,5H2 |
| InChIKey | RHESSRURVJCEIR-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |