C28H24N2O — CID 174376523
2H-1,5-benzodiazepine;3,4,5,6-tetrahydro-2H-chrysen-1-ylidenemethanone (PubChem CID 174376523) has the molecular formula C28H24N2O and a molecular weight of 404.51 g/mol. Its IUPAC name is 2H-1,5-benzodiazepine;3,4,5,6-tetrahydro-2H-chrysen-1-ylidenemethanone.
| Compound Name | 2H-1,5-benzodiazepine;3,4,5,6-tetrahydro-2H-chrysen-1-ylidenemethanone |
|---|---|
| PubChem CID | 174376523 |
| Molecular Formula | C28H24N2O |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 2H-1,5-benzodiazepine;3,4,5,6-tetrahydro-2H-chrysen-1-ylidenemethanone |
| SMILES | C1=CN=c2ccccc2=NC1.O=C=C1CCCc2c1ccc1c2CCc2ccccc2-1 |
| InChI | InChI=1S/C19H16O.C9H8N2/c20-12-14-5-3-7-17-16(14)10-11-18-15-6-2-1-4-13(15)8-9-19(17)18;1-2-5-9-8(4-1)10-6-3-7-11-9/h1-2,4,6,10-11H,3,5,7-9H2;1-6H,7H2 |
| InChIKey | CJXVPLDMGHJXQX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|