C34H33NS — CID 174461966
2,4-benzothiazepine;cyclohepta-1,3,5-triene;1,2,3,4,5,6-hexahydrochrysene (PubChem CID 174461966) has the molecular formula C34H33NS and a molecular weight of 487.71 g/mol. Its IUPAC name is 2,4-benzothiazepine;cyclohepta-1,3,5-triene;1,2,3,4,5,6-hexahydrochrysene.
| Compound Name | 2,4-benzothiazepine;cyclohepta-1,3,5-triene;1,2,3,4,5,6-hexahydrochrysene |
|---|---|
| PubChem CID | 174461966 |
| Molecular Formula | C34H33NS |
| Molecular Weight | 487.71 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 2,4-benzothiazepine;cyclohepta-1,3,5-triene;1,2,3,4,5,6-hexahydrochrysene |
| SMILES | C1=CC=CCC=C1.C1=NC=c2ccccc2=CS1.c1ccc2c(c1)CCc1c-2ccc2c1CCCC2 |
| InChI | InChI=1S/C18H18.C9H7NS.C7H8/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-4-9-6-11-7-10-5-8(9)3-1;1-2-4-6-7-5-3-1/h1,3,5,7,10,12H,2,4,6,8-9,11H2;1-7H;1-6H,7H2 |
| InChIKey | GKZSTTLKELLDFL-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.71 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |