About 2-[amino(2H-tetrazol-5-yl)amino]ethanol;barium(2+);hydride
2-[amino(2H-tetrazol-5-yl)amino]ethanol;barium(2+);hydride (PubChem CID 174721817) has the molecular formula C3H10BaN6O
and a molecular weight of 283.48 g/mol. Its IUPAC name is 2-[amino(2H-tetrazol-5-yl)amino]ethanol;barium(2+);hydride.
Molecular Properties
| Compound Name | 2-[amino(2H-tetrazol-5-yl)amino]ethanol;barium(2+);hydride |
| PubChem CID | 174721817 |
| Molecular Formula | C3H10BaN6O |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 2-[amino(2H-tetrazol-5-yl)amino]ethanol;barium(2+);hydride |
| SMILES | NN(CCO)c1nn[nH]n1.[Ba+2].[H-].[H-] |
| InChI | InChI=1S/C3H8N6O.Ba.2H/c4-9(1-2-10)3-5-7-8-6-3;;;/h10H,1-2,4H2,(H,5,6,7,8);;;/q;+2;2*-1 |
| InChIKey | MVDAQTXFAJKDBD-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[amino(2H-tetrazol-5-yl)amino]ethanol;barium(2+);hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[amino(2H-tetrazol-5-yl)amino]ethanol;barium(2+);hydride?
The IUPAC name of 2-[amino(2H-tetrazol-5-yl)amino]ethanol;barium(2+);hydride (CID 174721817) is 2-[amino(2H-tetrazol-5-yl)amino]ethanol;barium(2+);hydride.
What is the SMILES notation for 2-[amino(2H-tetrazol-5-yl)amino]ethanol;barium(2+);hydride?
The canonical SMILES for 2-[amino(2H-tetrazol-5-yl)amino]ethanol;barium(2+);hydride is NN(CCO)c1nn[nH]n1.[Ba+2].[H-].[H-].
What is the InChIKey of 2-[amino(2H-tetrazol-5-yl)amino]ethanol;barium(2+);hydride?
The InChIKey is MVDAQTXFAJKDBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N6O.Ba.2H/c4-9(1-2-10)3-5-7-8-6-3;;;/h10H,1-2,4H2,(H,5,6,7,8);;;/q;+2;2*-1.
What are the key properties of 2-[amino(2H-tetrazol-5-yl)amino]ethanol;barium(2+);hydride?
2-[amino(2H-tetrazol-5-yl)amino]ethanol;barium(2+);hydride has a molecular weight of 283.48 g/mol, XLogP of -2.28, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[amino(2H-tetrazol-5-yl)amino]ethanol;barium(2+);hydride is sourced from PubChem (CID 174721817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).