C4H5N9 — CID 68503393
N-ethenyl-N-(2H-tetrazol-5-yl)-2H-tetrazol-5-amine (PubChem CID 68503393) has the molecular formula C4H5N9 and a molecular weight of 179.15 g/mol. Its IUPAC name is N-ethenyl-N-(2H-tetrazol-5-yl)-2H-tetrazol-5-amine.
| Compound Name | N-ethenyl-N-(2H-tetrazol-5-yl)-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 68503393 |
| Molecular Formula | C4H5N9 |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | N-ethenyl-N-(2H-tetrazol-5-yl)-2H-tetrazol-5-amine |
| SMILES | C=CN(c1nn[nH]n1)c1nn[nH]n1 |
| InChI | InChI=1S/C4H5N9/c1-2-13(3-5-9-10-6-3)4-7-11-12-8-4/h2H,1H2,(H,5,6,9,10)(H,7,8,11,12) |
| InChIKey | XVVWENMRENAIBH-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |