C14H22N2O3S — CID 174721923
tert-butyl formate;piperidin-1-yl(1,3-thiazol-2-yl)methanone (PubChem CID 174721923) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is tert-butyl formate;piperidin-1-yl(1,3-thiazol-2-yl)methanone.
| Compound Name | tert-butyl formate;piperidin-1-yl(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 174721923 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | tert-butyl formate;piperidin-1-yl(1,3-thiazol-2-yl)methanone |
| SMILES | CC(C)(C)OC=O.O=C(c1nccs1)N1CCCCC1 |
| InChI | InChI=1S/C9H12N2OS.C5H10O2/c12-9(8-10-4-7-13-8)11-5-2-1-3-6-11;1-5(2,3)7-4-6/h4,7H,1-3,5-6H2;4H,1-3H3 |
| InChIKey | GRWULOUHXOTWCK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|