C20H21ClN2OS — CID 174722983
3-butyl-2-(4-chlorophenyl)-5-phenyl-2H-1,3-thiazole-4-carboxamide (PubChem CID 174722983) has the molecular formula C20H21ClN2OS and a molecular weight of 372.92 g/mol. Its IUPAC name is 3-butyl-2-(4-chlorophenyl)-5-phenyl-2H-1,3-thiazole-4-carboxamide.
| Compound Name | 3-butyl-2-(4-chlorophenyl)-5-phenyl-2H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 174722983 |
| Molecular Formula | C20H21ClN2OS |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 3-butyl-2-(4-chlorophenyl)-5-phenyl-2H-1,3-thiazole-4-carboxamide |
| SMILES | CCCCN1C(C(N)=O)=C(c2ccccc2)SC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2OS/c1-2-3-13-23-17(19(22)24)18(14-7-5-4-6-8-14)25-20(23)15-9-11-16(21)12-10-15/h4-12,20H,2-3,13H2,1H3,(H2,22,24) |
| InChIKey | CWHITLVVTIATRE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |