C12H22N2O6 — CID 174731876
1-O,3-O-bis(aminomethyl) 1-O-tert-butyl (1R)-propane-1,1,3-tricarboxylate (PubChem CID 174731876) has the molecular formula C12H22N2O6 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1-O,3-O-bis(aminomethyl) 1-O-tert-butyl (1R)-propane-1,1,3-tricarboxylate.
| Compound Name | 1-O,3-O-bis(aminomethyl) 1-O-tert-butyl (1R)-propane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 174731876 |
| Molecular Formula | C12H22N2O6 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-O,3-O-bis(aminomethyl) 1-O-tert-butyl (1R)-propane-1,1,3-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H](CCC(=O)OCN)C(=O)OCN |
| InChI | InChI=1S/C12H22N2O6/c1-12(2,3)20-11(17)8(10(16)19-7-14)4-5-9(15)18-6-13/h8H,4-7,13-14H2,1-3H3/t8-/m0/s1 |
| InChIKey | XGZFCNOESJICGN-QMMMGPOBSA-N |
| XLogP | -0.36 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|