C7H11NO5S — CID 174738579
(2,5-dioxo-3-propylpyrrolidin-1-yl) hydrogen sulfite (PubChem CID 174738579) has the molecular formula C7H11NO5S and a molecular weight of 221.23 g/mol. Its IUPAC name is (2,5-dioxo-3-propylpyrrolidin-1-yl) hydrogen sulfite.
| Compound Name | (2,5-dioxo-3-propylpyrrolidin-1-yl) hydrogen sulfite |
|---|---|
| PubChem CID | 174738579 |
| Molecular Formula | C7H11NO5S |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | (2,5-dioxo-3-propylpyrrolidin-1-yl) hydrogen sulfite |
| SMILES | CCCC1CC(=O)N(OS(=O)O)C1=O |
| InChI | InChI=1S/C7H11NO5S/c1-2-3-5-4-6(9)8(7(5)10)13-14(11)12/h5H,2-4H2,1H3,(H,11,12) |
| InChIKey | AIMJDVQZJVBLDY-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|