C18H21ClO2 — CID 174746011
1-chloroprop-1-ene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol (PubChem CID 174746011) has the molecular formula C18H21ClO2 and a molecular weight of 304.82 g/mol. Its IUPAC name is 1-chloroprop-1-ene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol.
| Compound Name | 1-chloroprop-1-ene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| PubChem CID | 174746011 |
| Molecular Formula | C18H21ClO2 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-chloroprop-1-ene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.CC=CCl |
| InChI | InChI=1S/C15H16O2.C3H5Cl/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;1-2-3-4/h3-10,16-17H,1-2H3;2-3H,1H3 |
| InChIKey | OSGVMMBHFCRITC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |