C17H18N2O8 — CID 174752267
2-(1,3-dioxoisoindol-2-yl)-2,3-dihydroxy-3-piperidin-1-ylbutanedioic acid (PubChem CID 174752267) has the molecular formula C17H18N2O8 and a molecular weight of 378.34 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-2,3-dihydroxy-3-piperidin-1-ylbutanedioic acid.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-2,3-dihydroxy-3-piperidin-1-ylbutanedioic acid |
|---|---|
| PubChem CID | 174752267 |
| Molecular Formula | C17H18N2O8 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-2,3-dihydroxy-3-piperidin-1-ylbutanedioic acid |
| SMILES | O=C1c2ccccc2C(=O)N1C(O)(C(=O)O)C(O)(C(=O)O)N1CCCCC1 |
| InChI | InChI=1S/C17H18N2O8/c20-12-10-6-2-3-7-11(10)13(21)19(12)17(27,15(24)25)16(26,14(22)23)18-8-4-1-5-9-18/h2-3,6-7,26-27H,1,4-5,8-9H2,(H,22,23)(H,24,25) |
| InChIKey | XDSCVBAEDSUMSK-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|