C19H26N2O4S — CID 59102616
[3-(1,3-dioxoisoindol-2-yl)-2,3-dimethylbutan-2-yl] piperidine-1-sulfinate (PubChem CID 59102616) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is [3-(1,3-dioxoisoindol-2-yl)-2,3-dimethylbutan-2-yl] piperidine-1-sulfinate.
| Compound Name | [3-(1,3-dioxoisoindol-2-yl)-2,3-dimethylbutan-2-yl] piperidine-1-sulfinate |
|---|---|
| PubChem CID | 59102616 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [3-(1,3-dioxoisoindol-2-yl)-2,3-dimethylbutan-2-yl] piperidine-1-sulfinate |
| SMILES | CC(C)(OS(=O)N1CCCCC1)C(C)(C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H26N2O4S/c1-18(2,19(3,4)25-26(24)20-12-8-5-9-13-20)21-16(22)14-10-6-7-11-15(14)17(21)23/h6-7,10-11H,5,8-9,12-13H2,1-4H3 |
| InChIKey | QGHBJSQDYMSXSL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|