About 1-(4-iodobutoxy)ethanol
1-(4-iodobutoxy)ethanol (PubChem CID 174760093) has the molecular formula C6H13IO2
and a molecular weight of 244.07 g/mol. Its IUPAC name is 1-(4-iodobutoxy)ethanol.
Molecular Properties
| Compound Name | 1-(4-iodobutoxy)ethanol |
| PubChem CID | 174760093 |
| Molecular Formula | C6H13IO2 |
| Molecular Weight | 244.07 g/mol |
| Exact Mass | 244.00 |
| IUPAC Name | 1-(4-iodobutoxy)ethanol |
| SMILES | CC(O)OCCCCI |
| InChI | InChI=1S/C6H13IO2/c1-6(8)9-5-3-2-4-7/h6,8H,2-5H2,1H3 |
| InChIKey | GUBTVFQOJHRLHH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.07 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-iodobutoxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-iodobutoxy)ethanol?
The IUPAC name of 1-(4-iodobutoxy)ethanol (CID 174760093) is 1-(4-iodobutoxy)ethanol.
What is the SMILES notation for 1-(4-iodobutoxy)ethanol?
The canonical SMILES for 1-(4-iodobutoxy)ethanol is CC(O)OCCCCI.
What is the InChIKey of 1-(4-iodobutoxy)ethanol?
The InChIKey is GUBTVFQOJHRLHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13IO2/c1-6(8)9-5-3-2-4-7/h6,8H,2-5H2,1H3.
What are the key properties of 1-(4-iodobutoxy)ethanol?
1-(4-iodobutoxy)ethanol has a molecular weight of 244.07 g/mol, XLogP of 1.56, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-iodobutoxy)ethanol is sourced from PubChem (CID 174760093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).