C11H24O — CID 174760883
2-methoxy-3,7-dimethyloctane (PubChem CID 174760883) has the molecular formula C11H24O and a molecular weight of 172.31 g/mol. Its IUPAC name is 2-methoxy-3,7-dimethyloctane.
| Compound Name | 2-methoxy-3,7-dimethyloctane |
|---|---|
| PubChem CID | 174760883 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | 2-methoxy-3,7-dimethyloctane |
| SMILES | COC(C)C(C)CCCC(C)C |
| InChI | InChI=1S/C11H24O/c1-9(2)7-6-8-10(3)11(4)12-5/h9-11H,6-8H2,1-5H3 |
| InChIKey | UKEMTLUDQYLDPT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |