C18H15N9O2S — CID 174764749
1-amino-1-[6-[amino(carbamoyl)amino]-3,5-dicyano-4-quinolin-4-yl-4H-thiopyran-2-yl]urea (PubChem CID 174764749) has the molecular formula C18H15N9O2S and a molecular weight of 421.45 g/mol. Its IUPAC name is 1-amino-1-[6-[amino(carbamoyl)amino]-3,5-dicyano-4-quinolin-4-yl-4H-thiopyran-2-yl]urea.
| Compound Name | 1-amino-1-[6-[amino(carbamoyl)amino]-3,5-dicyano-4-quinolin-4-yl-4H-thiopyran-2-yl]urea |
|---|---|
| PubChem CID | 174764749 |
| Molecular Formula | C18H15N9O2S |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 1-amino-1-[6-[amino(carbamoyl)amino]-3,5-dicyano-4-quinolin-4-yl-4H-thiopyran-2-yl]urea |
| SMILES | N#CC1=C(N(N)C(N)=O)SC(N(N)C(N)=O)=C(C#N)C1c1ccnc2ccccc12 |
| InChI | InChI=1S/C18H15N9O2S/c19-7-11-14(10-5-6-25-13-4-2-1-3-9(10)13)12(8-20)16(27(24)18(22)29)30-15(11)26(23)17(21)28/h1-6,14H,23-24H2,(H2,21,28)(H2,22,29) |
| InChIKey | MVGYULOGMPKZIE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 205.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|