C10H5N5O4 — CID 174766697
[3-cyano-4-(3-nitro-1,2,4-triazol-1-yl)phenyl] formate (PubChem CID 174766697) has the molecular formula C10H5N5O4 and a molecular weight of 259.18 g/mol. Its IUPAC name is [3-cyano-4-(3-nitro-1,2,4-triazol-1-yl)phenyl] formate.
| Compound Name | [3-cyano-4-(3-nitro-1,2,4-triazol-1-yl)phenyl] formate |
|---|---|
| PubChem CID | 174766697 |
| Molecular Formula | C10H5N5O4 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | [3-cyano-4-(3-nitro-1,2,4-triazol-1-yl)phenyl] formate |
| SMILES | N#Cc1cc(OC=O)ccc1-n1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H5N5O4/c11-4-7-3-8(19-6-16)1-2-9(7)14-5-12-10(13-14)15(17)18/h1-3,5-6H |
| InChIKey | GRNVPZOQWXGIPV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 123.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|