About calcium;nonadecanoic acid;carbonate
calcium;nonadecanoic acid;carbonate (PubChem CID 174780651) has the molecular formula C20H38CaO5
and a molecular weight of 398.60 g/mol. Its IUPAC name is calcium;nonadecanoic acid;carbonate.
Molecular Properties
| Compound Name | calcium;nonadecanoic acid;carbonate |
| PubChem CID | 174780651 |
| Molecular Formula | C20H38CaO5 |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | calcium;nonadecanoic acid;carbonate |
| SMILES | CCCCCCCCCCCCCCCCCCC(=O)O.O=C([O-])[O-].[Ca+2] |
| InChI | InChI=1S/C19H38O2.CH2O3.Ca/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21;2-1(3)4;/h2-18H2,1H3,(H,20,21);(H2,2,3,4);/q;;+2/p-2 |
| InChIKey | BCMZRYMWKNQOJQ-UHFFFAOYSA-L |
| XLogP | 3.89 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze calcium;nonadecanoic acid;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;nonadecanoic acid;carbonate?
The IUPAC name of calcium;nonadecanoic acid;carbonate (CID 174780651) is calcium;nonadecanoic acid;carbonate.
What is the SMILES notation for calcium;nonadecanoic acid;carbonate?
The canonical SMILES for calcium;nonadecanoic acid;carbonate is CCCCCCCCCCCCCCCCCCC(=O)O.O=C([O-])[O-].[Ca+2].
What is the InChIKey of calcium;nonadecanoic acid;carbonate?
The InChIKey is BCMZRYMWKNQOJQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C19H38O2.CH2O3.Ca/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21;2-1(3)4;/h2-18H2,1H3,(H,20,21);(H2,2,3,4);/q;;+2/p-2.
What are the key properties of calcium;nonadecanoic acid;carbonate?
calcium;nonadecanoic acid;carbonate has a molecular weight of 398.60 g/mol, XLogP of 3.89, 17 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;nonadecanoic acid;carbonate is sourced from PubChem (CID 174780651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).