C21H23NO8 — CID 174784864
[4-[1-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-1-(4-hydroxyphenyl)propyl]phenyl] nitrate (PubChem CID 174784864) has the molecular formula C21H23NO8 and a molecular weight of 417.41 g/mol. Its IUPAC name is [4-[1-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-1-(4-hydroxyphenyl)propyl]phenyl] nitrate.
| Compound Name | [4-[1-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-1-(4-hydroxyphenyl)propyl]phenyl] nitrate |
|---|---|
| PubChem CID | 174784864 |
| Molecular Formula | C21H23NO8 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | [4-[1-[(3S,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]-1-(4-hydroxyphenyl)propyl]phenyl] nitrate |
| SMILES | CCC(c1ccc(O)cc1)(c1ccc(O[N+](=O)[O-])cc1)[C@]1(O)CO[C@@H]2[C@@H](O)CO[C@@H]21 |
| InChI | InChI=1S/C21H23NO8/c1-2-20(13-3-7-15(23)8-4-13,14-5-9-16(10-6-14)30-22(26)27)21(25)12-29-18-17(24)11-28-19(18)21/h3-10,17-19,23-25H,2,11-12H2,1H3/t17-,18+,19-,20?,21-/m0/s1 |
| InChIKey | AVCJLVODKFTSTO-GKCYTULTSA-N |
| XLogP | 1.55 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|