About ethyl propanoate;1,3-thiazole
ethyl propanoate;1,3-thiazole (PubChem CID 174786803) has the molecular formula C8H13NO2S
and a molecular weight of 187.26 g/mol. Its IUPAC name is ethyl propanoate;1,3-thiazole.
Molecular Properties
| Compound Name | ethyl propanoate;1,3-thiazole |
| PubChem CID | 174786803 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | ethyl propanoate;1,3-thiazole |
| SMILES | CCOC(=O)CC.c1cscn1 |
| InChI | InChI=1S/C5H10O2.C3H3NS/c1-3-5(6)7-4-2;1-2-5-3-4-1/h3-4H2,1-2H3;1-3H |
| InChIKey | JRTFBJXUXWZBPO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl propanoate;1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl propanoate;1,3-thiazole?
The IUPAC name of ethyl propanoate;1,3-thiazole (CID 174786803) is ethyl propanoate;1,3-thiazole.
What is the SMILES notation for ethyl propanoate;1,3-thiazole?
The canonical SMILES for ethyl propanoate;1,3-thiazole is CCOC(=O)CC.c1cscn1.
What is the InChIKey of ethyl propanoate;1,3-thiazole?
The InChIKey is JRTFBJXUXWZBPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.C3H3NS/c1-3-5(6)7-4-2;1-2-5-3-4-1/h3-4H2,1-2H3;1-3H.
What are the key properties of ethyl propanoate;1,3-thiazole?
ethyl propanoate;1,3-thiazole has a molecular weight of 187.26 g/mol, XLogP of 2.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl propanoate;1,3-thiazole is sourced from PubChem (CID 174786803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).