C16H22N2O3 — CID 174791796
5-(1,3-benzodioxol-5-yl)-4-piperazin-1-ylpentanal (PubChem CID 174791796) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-4-piperazin-1-ylpentanal.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-4-piperazin-1-ylpentanal |
|---|---|
| PubChem CID | 174791796 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-4-piperazin-1-ylpentanal |
| SMILES | O=CCCC(Cc1ccc2c(c1)OCO2)N1CCNCC1 |
| InChI | InChI=1S/C16H22N2O3/c19-9-1-2-14(18-7-5-17-6-8-18)10-13-3-4-15-16(11-13)21-12-20-15/h3-4,9,11,14,17H,1-2,5-8,10,12H2 |
| InChIKey | BCUAYIKHJOLHNC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|