C23H39NO3S — CID 22935367
5-(2-octylsulfinylpropyl)-1,3-benzodioxole;piperidine (PubChem CID 22935367) has the molecular formula C23H39NO3S and a molecular weight of 409.64 g/mol. Its IUPAC name is 5-(2-octylsulfinylpropyl)-1,3-benzodioxole;piperidine.
| Compound Name | 5-(2-octylsulfinylpropyl)-1,3-benzodioxole;piperidine |
|---|---|
| PubChem CID | 22935367 |
| Molecular Formula | C23H39NO3S |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 5-(2-octylsulfinylpropyl)-1,3-benzodioxole;piperidine |
| SMILES | C1CCNCC1.CCCCCCCCS(=O)C(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H28O3S.C5H11N/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17;1-2-4-6-5-3-1/h9-10,13,15H,3-8,11-12,14H2,1-2H3;6H,1-5H2 |
| InChIKey | FUCAZCRSDGGFGS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|