C30H36Cl2O3S — CID 67687436
1-chloro-2-(2-chlorophenyl)benzene;5-(2-octylsulfinylpropyl)-1,3-benzodioxole (PubChem CID 67687436) has the molecular formula C30H36Cl2O3S and a molecular weight of 547.59 g/mol. Its IUPAC name is 1-chloro-2-(2-chlorophenyl)benzene;5-(2-octylsulfinylpropyl)-1,3-benzodioxole.
| Compound Name | 1-chloro-2-(2-chlorophenyl)benzene;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 67687436 |
| Molecular Formula | C30H36Cl2O3S |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 1-chloro-2-(2-chlorophenyl)benzene;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
| SMILES | CCCCCCCCS(=O)C(C)Cc1ccc2c(c1)OCO2.Clc1ccccc1-c1ccccc1Cl |
| InChI | InChI=1S/C18H28O3S.C12H8Cl2/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17;13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h9-10,13,15H,3-8,11-12,14H2,1-2H3;1-8H |
| InChIKey | BBOKDGCQUNSZBM-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|