C20H34O4S — CID 66735011
ethanol;5-(2-octylsulfinylpropyl)-1,3-benzodioxole (PubChem CID 66735011) has the molecular formula C20H34O4S and a molecular weight of 370.56 g/mol. Its IUPAC name is ethanol;5-(2-octylsulfinylpropyl)-1,3-benzodioxole.
| Compound Name | ethanol;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 66735011 |
| Molecular Formula | C20H34O4S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | ethanol;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
| SMILES | CCCCCCCCS(=O)C(C)Cc1ccc2c(c1)OCO2.CCO |
| InChI | InChI=1S/C18H28O3S.C2H6O/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17;1-2-3/h9-10,13,15H,3-8,11-12,14H2,1-2H3;3H,2H2,1H3 |
| InChIKey | VQJXWZCUJNHOOO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|