C20H36NO8PS — CID 67858847
acetamide;5-(2-octylsulfinylpropyl)-1,3-benzodioxole;phosphoric acid (PubChem CID 67858847) has the molecular formula C20H36NO8PS and a molecular weight of 481.55 g/mol. Its IUPAC name is acetamide;5-(2-octylsulfinylpropyl)-1,3-benzodioxole;phosphoric acid.
| Compound Name | acetamide;5-(2-octylsulfinylpropyl)-1,3-benzodioxole;phosphoric acid |
|---|---|
| PubChem CID | 67858847 |
| Molecular Formula | C20H36NO8PS |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | acetamide;5-(2-octylsulfinylpropyl)-1,3-benzodioxole;phosphoric acid |
| SMILES | CC(N)=O.CCCCCCCCS(=O)C(C)Cc1ccc2c(c1)OCO2.O=P(O)(O)O |
| InChI | InChI=1S/C18H28O3S.C2H5NO.H3O4P/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17;1-2(3)4;1-5(2,3)4/h9-10,13,15H,3-8,11-12,14H2,1-2H3;1H3,(H2,3,4);(H3,1,2,3,4) |
| InChIKey | ZYTNGBSVXSUXCC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|