C23H39NO5S2 — CID 66586574
2-amino-4-methylsulfanylbutanoic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole (PubChem CID 66586574) has the molecular formula C23H39NO5S2 and a molecular weight of 473.70 g/mol. Its IUPAC name is 2-amino-4-methylsulfanylbutanoic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole.
| Compound Name | 2-amino-4-methylsulfanylbutanoic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 66586574 |
| Molecular Formula | C23H39NO5S2 |
| Molecular Weight | 473.70 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 2-amino-4-methylsulfanylbutanoic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
| SMILES | CCCCCCCCS(=O)C(C)Cc1ccc2c(c1)OCO2.CSCCC(N)C(=O)O |
| InChI | InChI=1S/C18H28O3S.C5H11NO2S/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17;1-9-3-2-4(6)5(7)8/h9-10,13,15H,3-8,11-12,14H2,1-2H3;4H,2-3,6H2,1H3,(H,7,8) |
| InChIKey | YIFVIPYAESAEJV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.70 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|