C29H52N2O7S3 — CID 67575073
(2S)-2-amino-4-ethylsulfanylbutanoic acid;2-amino-4-methylsulfanylbutanoic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole (PubChem CID 67575073) has the molecular formula C29H52N2O7S3 and a molecular weight of 636.94 g/mol. Its IUPAC name is (2S)-2-amino-4-ethylsulfanylbutanoic acid;2-amino-4-methylsulfanylbutanoic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole.
| Compound Name | (2S)-2-amino-4-ethylsulfanylbutanoic acid;2-amino-4-methylsulfanylbutanoic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 67575073 |
| Molecular Formula | C29H52N2O7S3 |
| Molecular Weight | 636.94 g/mol |
| Exact Mass | 636.29 |
| IUPAC Name | (2S)-2-amino-4-ethylsulfanylbutanoic acid;2-amino-4-methylsulfanylbutanoic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
| SMILES | CCCCCCCCS(=O)C(C)Cc1ccc2c(c1)OCO2.CCSCC[C@H](N)C(=O)O.CSCCC(N)C(=O)O |
| InChI | InChI=1S/C18H28O3S.C6H13NO2S.C5H11NO2S/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17;1-2-10-4-3-5(7)6(8)9;1-9-3-2-4(6)5(7)8/h9-10,13,15H,3-8,11-12,14H2,1-2H3;5H,2-4,7H2,1H3,(H,8,9);4H,2-3,6H2,1H3,(H,7,8)/t;5-;/m.0./s1 |
| InChIKey | BYHJWOHFCAPSLV-NXAOXGSFSA-N |
| XLogP | 5.15 |
| TPSA | 162.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.94 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|