C23H37NO7S2 — CID 66608230
2-amino-3-(carboxymethylsulfanyl)propanoic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole (PubChem CID 66608230) has the molecular formula C23H37NO7S2 and a molecular weight of 503.68 g/mol. Its IUPAC name is 2-amino-3-(carboxymethylsulfanyl)propanoic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole.
| Compound Name | 2-amino-3-(carboxymethylsulfanyl)propanoic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 66608230 |
| Molecular Formula | C23H37NO7S2 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 2-amino-3-(carboxymethylsulfanyl)propanoic acid;5-(2-octylsulfinylpropyl)-1,3-benzodioxole |
| SMILES | CCCCCCCCS(=O)C(C)Cc1ccc2c(c1)OCO2.NC(CSCC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H28O3S.C5H9NO4S/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17;6-3(5(9)10)1-11-2-4(7)8/h9-10,13,15H,3-8,11-12,14H2,1-2H3;3H,1-2,6H2,(H,7,8)(H,9,10) |
| InChIKey | HXXSELCTQPAQIC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|