C33H58O6S — CID 173480293
5-(2-octylsulfinylpropyl)-1,3-benzodioxole;oxane (PubChem CID 173480293) has the molecular formula C33H58O6S and a molecular weight of 582.89 g/mol. Its IUPAC name is 5-(2-octylsulfinylpropyl)-1,3-benzodioxole;oxane.
| Compound Name | 5-(2-octylsulfinylpropyl)-1,3-benzodioxole;oxane |
|---|---|
| PubChem CID | 173480293 |
| Molecular Formula | C33H58O6S |
| Molecular Weight | 582.89 g/mol |
| Exact Mass | 582.40 |
| IUPAC Name | 5-(2-octylsulfinylpropyl)-1,3-benzodioxole;oxane |
| SMILES | C1CCOCC1.C1CCOCC1.C1CCOCC1.CCCCCCCCS(=O)C(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H28O3S.3C5H10O/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17;3*1-2-4-6-5-3-1/h9-10,13,15H,3-8,11-12,14H2,1-2H3;3*1-5H2 |
| InChIKey | NPFBKPSIOSZZNW-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.89 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|